C20H18F3N3O — CID 22032616
1-isoquinolin-5-yl-3-[2-[4-(trifluoromethyl)phenyl]propan-2-yl]urea (PubChem CID 22032616) has the molecular formula C20H18F3N3O and a molecular weight of 373.38 g/mol. Its IUPAC name is 1-isoquinolin-5-yl-3-[2-[4-(trifluoromethyl)phenyl]propan-2-yl]urea.
| Compound Name | 1-isoquinolin-5-yl-3-[2-[4-(trifluoromethyl)phenyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 22032616 |
| Molecular Formula | C20H18F3N3O |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-isoquinolin-5-yl-3-[2-[4-(trifluoromethyl)phenyl]propan-2-yl]urea |
| SMILES | CC(C)(NC(=O)Nc1cccc2cnccc12)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F3N3O/c1-19(2,14-6-8-15(9-7-14)20(21,22)23)26-18(27)25-17-5-3-4-13-12-24-11-10-16(13)17/h3-12H,1-2H3,(H2,25,26,27) |
| InChIKey | SSCRLESHHRUODZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |