C18H20N2O3 — CID 22035241
2-[(1-amino-1-oxo-4,4-diphenylbutan-2-yl)amino]acetic acid (PubChem CID 22035241) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[(1-amino-1-oxo-4,4-diphenylbutan-2-yl)amino]acetic acid.
| Compound Name | 2-[(1-amino-1-oxo-4,4-diphenylbutan-2-yl)amino]acetic acid |
|---|---|
| PubChem CID | 22035241 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[(1-amino-1-oxo-4,4-diphenylbutan-2-yl)amino]acetic acid |
| SMILES | NC(=O)C(CC(c1ccccc1)c1ccccc1)NCC(=O)O |
| InChI | InChI=1S/C18H20N2O3/c19-18(23)16(20-12-17(21)22)11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16,20H,11-12H2,(H2,19,23)(H,21,22) |
| InChIKey | NJUFSPGTUGUPBJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |