C16H18F2N4O2 — CID 22036368
2-[2-(2,6-difluorophenoxy)ethoxy]-3-piperazin-1-ylpyrazine (PubChem CID 22036368) has the molecular formula C16H18F2N4O2 and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[2-(2,6-difluorophenoxy)ethoxy]-3-piperazin-1-ylpyrazine.
| Compound Name | 2-[2-(2,6-difluorophenoxy)ethoxy]-3-piperazin-1-ylpyrazine |
|---|---|
| PubChem CID | 22036368 |
| Molecular Formula | C16H18F2N4O2 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-[2-(2,6-difluorophenoxy)ethoxy]-3-piperazin-1-ylpyrazine |
| SMILES | Fc1cccc(F)c1OCCOc1nccnc1N1CCNCC1 |
| InChI | InChI=1S/C16H18F2N4O2/c17-12-2-1-3-13(18)14(12)23-10-11-24-16-15(20-4-5-21-16)22-8-6-19-7-9-22/h1-5,19H,6-11H2 |
| InChIKey | HPILAGQWMWDJIK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|