C20H22N6O4 — CID 22036502
4-[3-[2-(2-aminoquinolin-8-yl)oxyethoxy]pyrazin-2-yl]piperazine-1-carboxylic acid (PubChem CID 22036502) has the molecular formula C20H22N6O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 4-[3-[2-(2-aminoquinolin-8-yl)oxyethoxy]pyrazin-2-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[3-[2-(2-aminoquinolin-8-yl)oxyethoxy]pyrazin-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 22036502 |
| Molecular Formula | C20H22N6O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[3-[2-(2-aminoquinolin-8-yl)oxyethoxy]pyrazin-2-yl]piperazine-1-carboxylic acid |
| SMILES | Nc1ccc2cccc(OCCOc3nccnc3N3CCN(C(=O)O)CC3)c2n1 |
| InChI | InChI=1S/C20H22N6O4/c21-16-5-4-14-2-1-3-15(17(14)24-16)29-12-13-30-19-18(22-6-7-23-19)25-8-10-26(11-9-25)20(27)28/h1-7H,8-13H2,(H2,21,24)(H,27,28) |
| InChIKey | VDVFDTGTVZCBNE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|