C21H24N6O7 — CID 22036400
(E)-but-2-enedioic acid;4-[2-(3-piperazin-1-ylpyrazin-2-yl)oxyethoxy]-1,3-benzoxazol-2-amine (PubChem CID 22036400) has the molecular formula C21H24N6O7 and a molecular weight of 472.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-[2-(3-piperazin-1-ylpyrazin-2-yl)oxyethoxy]-1,3-benzoxazol-2-amine.
| Compound Name | (E)-but-2-enedioic acid;4-[2-(3-piperazin-1-ylpyrazin-2-yl)oxyethoxy]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 22036400 |
| Molecular Formula | C21H24N6O7 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (E)-but-2-enedioic acid;4-[2-(3-piperazin-1-ylpyrazin-2-yl)oxyethoxy]-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2c(OCCOc3nccnc3N3CCNCC3)cccc2o1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H20N6O3.C4H4O4/c18-17-22-14-12(2-1-3-13(14)26-17)24-10-11-25-16-15(20-4-5-21-16)23-8-6-19-7-9-23;5-3(6)1-2-4(7)8/h1-5,19H,6-11H2,(H2,18,22);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | AWAITUGNUGDCTD-WLHGVMLRSA-N |
| XLogP | 0.78 |
| TPSA | 186.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|