C18H21N5O4 — CID 22036369
8-[2-(3-piperazin-1-ylpyrazin-2-yl)oxyethoxy]-4H-1,4-benzoxazin-3-one (PubChem CID 22036369) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 8-[2-(3-piperazin-1-ylpyrazin-2-yl)oxyethoxy]-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-[2-(3-piperazin-1-ylpyrazin-2-yl)oxyethoxy]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 22036369 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 8-[2-(3-piperazin-1-ylpyrazin-2-yl)oxyethoxy]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2c(cccc2OCCOc2nccnc2N2CCNCC2)N1 |
| InChI | InChI=1S/C18H21N5O4/c24-15-12-27-16-13(22-15)2-1-3-14(16)25-10-11-26-18-17(20-4-5-21-18)23-8-6-19-7-9-23/h1-5,19H,6-12H2,(H,22,24) |
| InChIKey | OBHKRFVTODKUAK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|