C13H17N3O2 — CID 82232263
9-piperazin-1-yl-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 82232263) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 9-piperazin-1-yl-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 9-piperazin-1-yl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 82232263 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 9-piperazin-1-yl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | O=C1CCOc2c(cccc2N2CCNCC2)N1 |
| InChI | InChI=1S/C13H17N3O2/c17-12-4-9-18-13-10(15-12)2-1-3-11(13)16-7-5-14-6-8-16/h1-3,14H,4-9H2,(H,15,17) |
| InChIKey | AQPYTAWGUVKKEP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |