C18H25N3O3 — CID 110664148
8-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 110664148) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 8-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 110664148 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 8-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C)(C)CC(=O)N1CCN(c2cccc3c2OCC(=O)N3)CC1 |
| InChI | InChI=1S/C18H25N3O3/c1-18(2,3)11-16(23)21-9-7-20(8-10-21)14-6-4-5-13-17(14)24-12-15(22)19-13/h4-6H,7-12H2,1-3H3,(H,19,22) |
| InChIKey | YYASSUPBPVFNQW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |