C17H17N5O3 — CID 110664099
8-[4-(pyrazine-2-carbonyl)piperazin-1-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 110664099) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 8-[4-(pyrazine-2-carbonyl)piperazin-1-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-[4-(pyrazine-2-carbonyl)piperazin-1-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 110664099 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 8-[4-(pyrazine-2-carbonyl)piperazin-1-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2c(cccc2N2CCN(C(=O)c3cnccn3)CC2)N1 |
| InChI | InChI=1S/C17H17N5O3/c23-15-11-25-16-12(20-15)2-1-3-14(16)21-6-8-22(9-7-21)17(24)13-10-18-4-5-19-13/h1-5,10H,6-9,11H2,(H,20,23) |
| InChIKey | JIEJDSIOYIJUTD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |