C20H22N6O3 — CID 22036619
1-(4-nitrophenyl)-3-[1-(2-pyrrolidin-1-ylethyl)indazol-5-yl]urea (PubChem CID 22036619) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-[1-(2-pyrrolidin-1-ylethyl)indazol-5-yl]urea.
| Compound Name | 1-(4-nitrophenyl)-3-[1-(2-pyrrolidin-1-ylethyl)indazol-5-yl]urea |
|---|---|
| PubChem CID | 22036619 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-(4-nitrophenyl)-3-[1-(2-pyrrolidin-1-ylethyl)indazol-5-yl]urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)Nc1ccc2c(cnn2CCN2CCCC2)c1 |
| InChI | InChI=1S/C20H22N6O3/c27-20(22-16-3-6-18(7-4-16)26(28)29)23-17-5-8-19-15(13-17)14-21-25(19)12-11-24-9-1-2-10-24/h3-8,13-14H,1-2,9-12H2,(H2,22,23,27) |
| InChIKey | ZBBVAHPUIRKHLA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|