C20H23F2N7O2 — CID 22036899
2-(difluoromethyl)-3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)benzimidazol-5-amine (PubChem CID 22036899) has the molecular formula C20H23F2N7O2 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-(difluoromethyl)-3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)benzimidazol-5-amine.
| Compound Name | 2-(difluoromethyl)-3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 22036899 |
| Molecular Formula | C20H23F2N7O2 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-(difluoromethyl)-3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(C(F)F)n(-c3nc(N4CCOCC4)cc(N4CCOCC4)n3)c2c1 |
| InChI | InChI=1S/C20H23F2N7O2/c21-18(22)19-24-14-2-1-13(23)11-15(14)29(19)20-25-16(27-3-7-30-8-4-27)12-17(26-20)28-5-9-31-10-6-28/h1-2,11-12,18H,3-10,23H2 |
| InChIKey | LLHRNYKBWUIXFG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|