C24H31F2N7O2 — CID 11955852
1-[4,6-bis(2,6-dimethylmorpholin-4-yl)pyrimidin-2-yl]-2-(difluoromethyl)benzimidazol-5-amine (PubChem CID 11955852) has the molecular formula C24H31F2N7O2 and a molecular weight of 487.56 g/mol. Its IUPAC name is 1-[4,6-bis(2,6-dimethylmorpholin-4-yl)pyrimidin-2-yl]-2-(difluoromethyl)benzimidazol-5-amine.
| Compound Name | 1-[4,6-bis(2,6-dimethylmorpholin-4-yl)pyrimidin-2-yl]-2-(difluoromethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 11955852 |
| Molecular Formula | C24H31F2N7O2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 1-[4,6-bis(2,6-dimethylmorpholin-4-yl)pyrimidin-2-yl]-2-(difluoromethyl)benzimidazol-5-amine |
| SMILES | CC1CN(c2cc(N3CC(C)OC(C)C3)nc(-n3c(C(F)F)nc4cc(N)ccc43)n2)CC(C)O1 |
| InChI | InChI=1S/C24H31F2N7O2/c1-13-9-31(10-14(2)34-13)20-8-21(32-11-15(3)35-16(4)12-32)30-24(29-20)33-19-6-5-17(27)7-18(19)28-23(33)22(25)26/h5-8,13-16,22H,9-12,27H2,1-4H3 |
| InChIKey | PYBWUZKLMWRYKH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|