C18H17FN4 — CID 22037247
4-[3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1H-pyrazol-4-yl]pyridine (PubChem CID 22037247) has the molecular formula C18H17FN4 and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1H-pyrazol-4-yl]pyridine.
| Compound Name | 4-[3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1H-pyrazol-4-yl]pyridine |
|---|---|
| PubChem CID | 22037247 |
| Molecular Formula | C18H17FN4 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1H-pyrazol-4-yl]pyridine |
| SMILES | Fc1ccc(-c2n[nH]c(C3CCCN3)c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C18H17FN4/c19-14-5-3-13(4-6-14)17-16(12-7-10-20-11-8-12)18(23-22-17)15-2-1-9-21-15/h3-8,10-11,15,21H,1-2,9H2,(H,22,23) |
| InChIKey | UBPUTSUHUNLPJH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |