C14H16BrN3S — CID 84611715
4-bromo-3-(4-methylsulfanylphenyl)-5-pyrrolidin-2-yl-1H-pyrazole (PubChem CID 84611715) has the molecular formula C14H16BrN3S and a molecular weight of 338.27 g/mol. Its IUPAC name is 4-bromo-3-(4-methylsulfanylphenyl)-5-pyrrolidin-2-yl-1H-pyrazole.
| Compound Name | 4-bromo-3-(4-methylsulfanylphenyl)-5-pyrrolidin-2-yl-1H-pyrazole |
|---|---|
| PubChem CID | 84611715 |
| Molecular Formula | C14H16BrN3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 4-bromo-3-(4-methylsulfanylphenyl)-5-pyrrolidin-2-yl-1H-pyrazole |
| SMILES | CSc1ccc(-c2n[nH]c(C3CCCN3)c2Br)cc1 |
| InChI | InChI=1S/C14H16BrN3S/c1-19-10-6-4-9(5-7-10)13-12(15)14(18-17-13)11-3-2-8-16-11/h4-7,11,16H,2-3,8H2,1H3,(H,17,18) |
| InChIKey | TZYTWCDJCMJBBA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |