C20H18N2O — CID 22040342
2-(dimethylamino)-N-[4-(4-phenylbuta-1,3-diynyl)phenyl]acetamide (PubChem CID 22040342) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[4-(4-phenylbuta-1,3-diynyl)phenyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[4-(4-phenylbuta-1,3-diynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 22040342 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-(dimethylamino)-N-[4-(4-phenylbuta-1,3-diynyl)phenyl]acetamide |
| SMILES | CN(C)CC(=O)Nc1ccc(C#CC#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N2O/c1-22(2)16-20(23)21-19-14-12-18(13-15-19)11-7-6-10-17-8-4-3-5-9-17/h3-5,8-9,12-15H,16H2,1-2H3,(H,21,23) |
| InChIKey | PPOGMEVKEYVANF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|