C23H20ClN5O3 — CID 22040957
N-[5-[[2-(2-amino-2-oxoethyl)-4-pyridinyl]oxy]-1-methylbenzimidazol-2-yl]-4-(chloromethyl)benzamide (PubChem CID 22040957) has the molecular formula C23H20ClN5O3 and a molecular weight of 449.90 g/mol. Its IUPAC name is N-[5-[[2-(2-amino-2-oxoethyl)-4-pyridinyl]oxy]-1-methylbenzimidazol-2-yl]-4-(chloromethyl)benzamide.
| Compound Name | N-[5-[[2-(2-amino-2-oxoethyl)-4-pyridinyl]oxy]-1-methylbenzimidazol-2-yl]-4-(chloromethyl)benzamide |
|---|---|
| PubChem CID | 22040957 |
| Molecular Formula | C23H20ClN5O3 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-[5-[[2-(2-amino-2-oxoethyl)-4-pyridinyl]oxy]-1-methylbenzimidazol-2-yl]-4-(chloromethyl)benzamide |
| SMILES | Cn1c(NC(=O)c2ccc(CCl)cc2)nc2cc(Oc3ccnc(CC(N)=O)c3)ccc21 |
| InChI | InChI=1S/C23H20ClN5O3/c1-29-20-7-6-17(32-18-8-9-26-16(10-18)11-21(25)30)12-19(20)27-23(29)28-22(31)15-4-2-14(13-24)3-5-15/h2-10,12H,11,13H2,1H3,(H2,25,30)(H,27,28,31) |
| InChIKey | OLDJEGRVOJOPHD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|