About 5-bromo-2,3-dihydroquinoline
5-bromo-2,3-dihydroquinoline (PubChem CID 22042156) has the molecular formula C9H8BrN
and a molecular weight of 210.07 g/mol. Its IUPAC name is 5-bromo-2,3-dihydroquinoline.
Molecular Properties
| Compound Name | 5-bromo-2,3-dihydroquinoline |
| PubChem CID | 22042156 |
| Molecular Formula | C9H8BrN |
| Molecular Weight | 210.07 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 5-bromo-2,3-dihydroquinoline |
| SMILES | Brc1cccc2c1=CCCN=2 |
| InChI | InChI=1S/C9H8BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1,3-5H,2,6H2 |
| InChIKey | LRKFAXDBBAKACN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.07 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2,3-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,3-dihydroquinoline?
The IUPAC name of 5-bromo-2,3-dihydroquinoline (CID 22042156) is 5-bromo-2,3-dihydroquinoline.
What is the SMILES notation for 5-bromo-2,3-dihydroquinoline?
The canonical SMILES for 5-bromo-2,3-dihydroquinoline is Brc1cccc2c1=CCCN=2.
What is the InChIKey of 5-bromo-2,3-dihydroquinoline?
The InChIKey is LRKFAXDBBAKACN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1,3-5H,2,6H2.
What are the key properties of 5-bromo-2,3-dihydroquinoline?
5-bromo-2,3-dihydroquinoline has a molecular weight of 210.07 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,3-dihydroquinoline is sourced from PubChem (CID 22042156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).