C28H27F3N2O4S — CID 22042563
N-[4-[3-[4-[benzenesulfonyl(2-methylpropyl)amino]phenyl]-4,4,4-trifluoro-3-hydroxybut-1-ynyl]phenyl]acetamide (PubChem CID 22042563) has the molecular formula C28H27F3N2O4S and a molecular weight of 544.60 g/mol. Its IUPAC name is N-[4-[3-[4-[benzenesulfonyl(2-methylpropyl)amino]phenyl]-4,4,4-trifluoro-3-hydroxybut-1-ynyl]phenyl]acetamide.
| Compound Name | N-[4-[3-[4-[benzenesulfonyl(2-methylpropyl)amino]phenyl]-4,4,4-trifluoro-3-hydroxybut-1-ynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 22042563 |
| Molecular Formula | C28H27F3N2O4S |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | N-[4-[3-[4-[benzenesulfonyl(2-methylpropyl)amino]phenyl]-4,4,4-trifluoro-3-hydroxybut-1-ynyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C#CC(O)(c2ccc(N(CC(C)C)S(=O)(=O)c3ccccc3)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H27F3N2O4S/c1-20(2)19-33(38(36,37)26-7-5-4-6-8-26)25-15-11-23(12-16-25)27(35,28(29,30)31)18-17-22-9-13-24(14-10-22)32-21(3)34/h4-16,20,35H,19H2,1-3H3,(H,32,34) |
| InChIKey | GQUVGNVCVSTXGA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|