C30H35FN2O4 — CID 22046582
benzyl N-[3-amino-4-(3-fluoro-5-prop-2-enoxyphenyl)-2-hydroxybutyl]-N-[(3-ethylphenyl)methyl]carbamate (PubChem CID 22046582) has the molecular formula C30H35FN2O4 and a molecular weight of 506.62 g/mol. Its IUPAC name is benzyl N-[3-amino-4-(3-fluoro-5-prop-2-enoxyphenyl)-2-hydroxybutyl]-N-[(3-ethylphenyl)methyl]carbamate.
| Compound Name | benzyl N-[3-amino-4-(3-fluoro-5-prop-2-enoxyphenyl)-2-hydroxybutyl]-N-[(3-ethylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 22046582 |
| Molecular Formula | C30H35FN2O4 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | benzyl N-[3-amino-4-(3-fluoro-5-prop-2-enoxyphenyl)-2-hydroxybutyl]-N-[(3-ethylphenyl)methyl]carbamate |
| SMILES | C=CCOc1cc(F)cc(CC(N)C(O)CN(Cc2cccc(CC)c2)C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H35FN2O4/c1-3-13-36-27-16-25(15-26(31)18-27)17-28(32)29(34)20-33(19-24-12-8-11-22(4-2)14-24)30(35)37-21-23-9-6-5-7-10-23/h3,5-12,14-16,18,28-29,34H,1,4,13,17,19-21,32H2,2H3 |
| InChIKey | NKABDPSKXPMDFG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|