C30H32ClN3O — CID 22049142
N-[3-[1-[[1-(2-chlorophenyl)indol-3-yl]methyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22049142) has the molecular formula C30H32ClN3O and a molecular weight of 486.06 g/mol. Its IUPAC name is N-[3-[1-[[1-(2-chlorophenyl)indol-3-yl]methyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[[1-(2-chlorophenyl)indol-3-yl]methyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22049142 |
| Molecular Formula | C30H32ClN3O |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | N-[3-[1-[[1-(2-chlorophenyl)indol-3-yl]methyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(Cc3cn(-c4ccccc4Cl)c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C30H32ClN3O/c1-21(2)30(35)32-25-9-7-8-23(18-25)22-14-16-33(17-15-22)19-24-20-34(28-12-5-3-10-26(24)28)29-13-6-4-11-27(29)31/h3-13,18,20-22H,14-17,19H2,1-2H3,(H,32,35) |
| InChIKey | SFUAFIUFVXQKIC-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |