C31H36FN3OP2 — CID 142203482
N-[3-[1-[[1-[2-[fluoro-bis(phosphanyl)methyl]phenyl]indol-4-yl]methyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 142203482) has the molecular formula C31H36FN3OP2 and a molecular weight of 547.60 g/mol. Its IUPAC name is N-[3-[1-[[1-[2-[fluoro-bis(phosphanyl)methyl]phenyl]indol-4-yl]methyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[[1-[2-[fluoro-bis(phosphanyl)methyl]phenyl]indol-4-yl]methyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 142203482 |
| Molecular Formula | C31H36FN3OP2 |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | N-[3-[1-[[1-[2-[fluoro-bis(phosphanyl)methyl]phenyl]indol-4-yl]methyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(Cc3cccc4c3ccn4-c3ccccc3C(F)(P)P)CC2)c1 |
| InChI | InChI=1S/C31H36FN3OP2/c1-21(2)30(36)33-25-9-5-7-23(19-25)22-13-16-34(17-14-22)20-24-8-6-12-28-26(24)15-18-35(28)29-11-4-3-10-27(29)31(32,37)38/h3-12,15,18-19,21-22H,13-14,16-17,20,37-38H2,1-2H3,(H,33,36) |
| InChIKey | UZJGWQMHNUXOPN-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|