C17H12Cl2F2O3S — CID 22049815
2-[bis(4-chlorophenyl)methylsulfanyl]-4,4-difluoro-3-oxobutanoic acid (PubChem CID 22049815) has the molecular formula C17H12Cl2F2O3S and a molecular weight of 405.25 g/mol. Its IUPAC name is 2-[bis(4-chlorophenyl)methylsulfanyl]-4,4-difluoro-3-oxobutanoic acid.
| Compound Name | 2-[bis(4-chlorophenyl)methylsulfanyl]-4,4-difluoro-3-oxobutanoic acid |
|---|---|
| PubChem CID | 22049815 |
| Molecular Formula | C17H12Cl2F2O3S |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 2-[bis(4-chlorophenyl)methylsulfanyl]-4,4-difluoro-3-oxobutanoic acid |
| SMILES | O=C(O)C(SC(c1ccc(Cl)cc1)c1ccc(Cl)cc1)C(=O)C(F)F |
| InChI | InChI=1S/C17H12Cl2F2O3S/c18-11-5-1-9(2-6-11)14(10-3-7-12(19)8-4-10)25-15(17(23)24)13(22)16(20)21/h1-8,14-16H,(H,23,24) |
| InChIKey | OXIAWYKOGJXHCK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|