C16H14Cl2OS — CID 22049857
1-[bis(4-chlorophenyl)methylsulfanyl]propan-2-one (PubChem CID 22049857) has the molecular formula C16H14Cl2OS and a molecular weight of 325.26 g/mol. Its IUPAC name is 1-[bis(4-chlorophenyl)methylsulfanyl]propan-2-one.
| Compound Name | 1-[bis(4-chlorophenyl)methylsulfanyl]propan-2-one |
|---|---|
| PubChem CID | 22049857 |
| Molecular Formula | C16H14Cl2OS |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 1-[bis(4-chlorophenyl)methylsulfanyl]propan-2-one |
| SMILES | CC(=O)CSC(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2OS/c1-11(19)10-20-16(12-2-6-14(17)7-3-12)13-4-8-15(18)9-5-13/h2-9,16H,10H2,1H3 |
| InChIKey | MQFQYGPNAGZCDT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |