C24H24FNO2Si — CID 22051088
1-[(3-fluorophenyl)methyl]-4-phenylmethoxy-3-(2-trimethylsilylethynyl)pyridin-2-one (PubChem CID 22051088) has the molecular formula C24H24FNO2Si and a molecular weight of 405.55 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-4-phenylmethoxy-3-(2-trimethylsilylethynyl)pyridin-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-4-phenylmethoxy-3-(2-trimethylsilylethynyl)pyridin-2-one |
|---|---|
| PubChem CID | 22051088 |
| Molecular Formula | C24H24FNO2Si |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-4-phenylmethoxy-3-(2-trimethylsilylethynyl)pyridin-2-one |
| SMILES | C[Si](C)(C)C#Cc1c(OCc2ccccc2)ccn(Cc2cccc(F)c2)c1=O |
| InChI | InChI=1S/C24H24FNO2Si/c1-29(2,3)15-13-22-23(28-18-19-8-5-4-6-9-19)12-14-26(24(22)27)17-20-10-7-11-21(25)16-20/h4-12,14,16H,17-18H2,1-3H3 |
| InChIKey | XNXZJUJRRXLBIX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|