C19H14F4N2O2 — CID 21090105
3-[(3-fluorophenyl)methyl]-6-phenylmethoxy-5-(trifluoromethyl)pyrimidin-4-one (PubChem CID 21090105) has the molecular formula C19H14F4N2O2 and a molecular weight of 378.33 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]-6-phenylmethoxy-5-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 3-[(3-fluorophenyl)methyl]-6-phenylmethoxy-5-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 21090105 |
| Molecular Formula | C19H14F4N2O2 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]-6-phenylmethoxy-5-(trifluoromethyl)pyrimidin-4-one |
| SMILES | O=c1c(C(F)(F)F)c(OCc2ccccc2)ncn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H14F4N2O2/c20-15-8-4-7-14(9-15)10-25-12-24-17(16(18(25)26)19(21,22)23)27-11-13-5-2-1-3-6-13/h1-9,12H,10-11H2 |
| InChIKey | QGRRWBWWERSFEM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |