C19H22ClN3O3 — CID 22052220
4-(2-chloro-4-methoxyphenyl)-N-(1-cyclobutylpropyl)-3-nitropyridin-2-amine (PubChem CID 22052220) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is 4-(2-chloro-4-methoxyphenyl)-N-(1-cyclobutylpropyl)-3-nitropyridin-2-amine.
| Compound Name | 4-(2-chloro-4-methoxyphenyl)-N-(1-cyclobutylpropyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 22052220 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-(2-chloro-4-methoxyphenyl)-N-(1-cyclobutylpropyl)-3-nitropyridin-2-amine |
| SMILES | CCC(Nc1nccc(-c2ccc(OC)cc2Cl)c1[N+](=O)[O-])C1CCC1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-3-17(12-5-4-6-12)22-19-18(23(24)25)15(9-10-21-19)14-8-7-13(26-2)11-16(14)20/h7-12,17H,3-6H2,1-2H3,(H,21,22) |
| InChIKey | ALFYSHPWVOKFBP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|