C17H17Cl2N3O2 — CID 62705475
N-[(1S)-1-cyclopropylpropyl]-4-(2,4-dichlorophenyl)-3-nitropyridin-2-amine (PubChem CID 62705475) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-[(1S)-1-cyclopropylpropyl]-4-(2,4-dichlorophenyl)-3-nitropyridin-2-amine.
| Compound Name | N-[(1S)-1-cyclopropylpropyl]-4-(2,4-dichlorophenyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 62705475 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[(1S)-1-cyclopropylpropyl]-4-(2,4-dichlorophenyl)-3-nitropyridin-2-amine |
| SMILES | CC[C@H](Nc1nccc(-c2ccc(Cl)cc2Cl)c1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-2-15(10-3-4-10)21-17-16(22(23)24)13(7-8-20-17)12-6-5-11(18)9-14(12)19/h5-10,15H,2-4H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | JDJSZWVVDGRWEV-HNNXBMFYSA-N |
| XLogP | 5.56 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|