C19H21ClN6O3 — CID 22055286
[1-[[4-(3-chloro-4-hydroxyanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidin-4-yl]carbamic acid (PubChem CID 22055286) has the molecular formula C19H21ClN6O3 and a molecular weight of 416.87 g/mol. Its IUPAC name is [1-[[4-(3-chloro-4-hydroxyanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[[4-(3-chloro-4-hydroxyanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 22055286 |
| Molecular Formula | C19H21ClN6O3 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [1-[[4-(3-chloro-4-hydroxyanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(Cc2ccn3ncnc(Nc4ccc(O)c(Cl)c4)c23)CC1 |
| InChI | InChI=1S/C19H21ClN6O3/c20-15-9-14(1-2-16(15)27)23-18-17-12(3-8-26(17)22-11-21-18)10-25-6-4-13(5-7-25)24-19(28)29/h1-3,8-9,11,13,24,27H,4-7,10H2,(H,28,29)(H,21,22,23) |
| InChIKey | LJEWCWCUSOYILA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|