C13H27N2+ — CID 22055632
1-cycloheptyl-1-methyl-1,4-diazepan-1-ium (PubChem CID 22055632) has the molecular formula C13H27N2+ and a molecular weight of 211.37 g/mol. Its IUPAC name is 1-cycloheptyl-1-methyl-1,4-diazepan-1-ium.
| Compound Name | 1-cycloheptyl-1-methyl-1,4-diazepan-1-ium |
|---|---|
| PubChem CID | 22055632 |
| Molecular Formula | C13H27N2+ |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.22 |
| IUPAC Name | 1-cycloheptyl-1-methyl-1,4-diazepan-1-ium |
| SMILES | C[N+]1(C2CCCCCC2)CCCNCC1 |
| InChI | InChI=1S/C13H27N2/c1-15(11-6-9-14-10-12-15)13-7-4-2-3-5-8-13/h13-14H,2-12H2,1H3/q+1 |
| InChIKey | JLJCMVKJAPSOTP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|