C10H19N2O+ — CID 124784782
(6S,10aS)-6-methyl-2,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-6-ium-3-one (PubChem CID 124784782) has the molecular formula C10H19N2O+ and a molecular weight of 183.27 g/mol. Its IUPAC name is (6S,10aS)-6-methyl-2,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-6-ium-3-one.
| Compound Name | (6S,10aS)-6-methyl-2,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-6-ium-3-one |
|---|---|
| PubChem CID | 124784782 |
| Molecular Formula | C10H19N2O+ |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | (6S,10aS)-6-methyl-2,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-6-ium-3-one |
| SMILES | C[N@@+]12CCCC[C@H]1CNC(=O)CC2 |
| InChI | InChI=1S/C10H18N2O/c1-12-6-3-2-4-9(12)8-11-10(13)5-7-12/h9H,2-8H2,1H3/p+1/t9-,12-/m0/s1 |
| InChIKey | XZANKJFLTAKDDW-CABZTGNLSA-O |
| XLogP | 0.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|