C9H17N2O+ — CID 98169136
(1S,6S)-9,9-dimethyl-3-aza-9-azoniabicyclo[4.2.1]nonan-4-one (PubChem CID 98169136) has the molecular formula C9H17N2O+ and a molecular weight of 169.25 g/mol. Its IUPAC name is (1S,6S)-9,9-dimethyl-3-aza-9-azoniabicyclo[4.2.1]nonan-4-one.
| Compound Name | (1S,6S)-9,9-dimethyl-3-aza-9-azoniabicyclo[4.2.1]nonan-4-one |
|---|---|
| PubChem CID | 98169136 |
| Molecular Formula | C9H17N2O+ |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (1S,6S)-9,9-dimethyl-3-aza-9-azoniabicyclo[4.2.1]nonan-4-one |
| SMILES | C[N+]1(C)[C@H]2CC[C@H]1CC(=O)NC2 |
| InChI | InChI=1S/C9H16N2O/c1-11(2)7-3-4-8(11)6-10-9(12)5-7/h7-8H,3-6H2,1-2H3/p+1/t7-,8-/m0/s1 |
| InChIKey | BSQQXJYFJLWDQE-YUMQZZPRSA-O |
| XLogP | 0.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|