C24H27ClFN5O3 — CID 22060776
5-chloro-4-[[5-fluoro-4-[4-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-2-yl]amino]-2-methylphenol (PubChem CID 22060776) has the molecular formula C24H27ClFN5O3 and a molecular weight of 487.96 g/mol. Its IUPAC name is 5-chloro-4-[[5-fluoro-4-[4-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-2-yl]amino]-2-methylphenol.
| Compound Name | 5-chloro-4-[[5-fluoro-4-[4-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-2-yl]amino]-2-methylphenol |
|---|---|
| PubChem CID | 22060776 |
| Molecular Formula | C24H27ClFN5O3 |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 5-chloro-4-[[5-fluoro-4-[4-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-2-yl]amino]-2-methylphenol |
| SMILES | Cc1cc(Nc2ncc(F)c(Nc3ccc(OCCCN4CCOCC4)cc3)n2)c(Cl)cc1O |
| InChI | InChI=1S/C24H27ClFN5O3/c1-16-13-21(19(25)14-22(16)32)29-24-27-15-20(26)23(30-24)28-17-3-5-18(6-4-17)34-10-2-7-31-8-11-33-12-9-31/h3-6,13-15,32H,2,7-12H2,1H3,(H2,27,28,29,30) |
| InChIKey | WSYQRSUVGWLTDU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|