C13H14BrClN4S — CID 2206236
1-(4-bromo-2-chlorophenyl)-3-[(1,5-dimethylpyrazol-3-yl)methyl]thiourea (PubChem CID 2206236) has the molecular formula C13H14BrClN4S and a molecular weight of 373.71 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-[(1,5-dimethylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-[(1,5-dimethylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 2206236 |
| Molecular Formula | C13H14BrClN4S |
| Molecular Weight | 373.71 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-[(1,5-dimethylpyrazol-3-yl)methyl]thiourea |
| SMILES | Cc1cc(CNC(=S)Nc2ccc(Br)cc2Cl)nn1C |
| InChI | InChI=1S/C13H14BrClN4S/c1-8-5-10(18-19(8)2)7-16-13(20)17-12-4-3-9(14)6-11(12)15/h3-6H,7H2,1-2H3,(H2,16,17,20) |
| InChIKey | SUHUYKCKQREDHS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.71 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|