About 5-methyl-2,3-dihydroisoindol-1-one
5-methyl-2,3-dihydroisoindol-1-one (PubChem CID 22064671) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 5-methyl-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 5-methyl-2,3-dihydroisoindol-1-one |
| PubChem CID | 22064671 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 5-methyl-2,3-dihydroisoindol-1-one |
| SMILES | Cc1ccc2c(c1)CNC2=O |
| InChI | InChI=1S/C9H9NO/c1-6-2-3-8-7(4-6)5-10-9(8)11/h2-4H,5H2,1H3,(H,10,11) |
| InChIKey | AHKBMKCIJLCNIH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3-dihydroisoindol-1-one?
The IUPAC name of 5-methyl-2,3-dihydroisoindol-1-one (CID 22064671) is 5-methyl-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 5-methyl-2,3-dihydroisoindol-1-one?
The canonical SMILES for 5-methyl-2,3-dihydroisoindol-1-one is Cc1ccc2c(c1)CNC2=O.
What is the InChIKey of 5-methyl-2,3-dihydroisoindol-1-one?
The InChIKey is AHKBMKCIJLCNIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c1-6-2-3-8-7(4-6)5-10-9(8)11/h2-4H,5H2,1H3,(H,10,11).
What are the key properties of 5-methyl-2,3-dihydroisoindol-1-one?
5-methyl-2,3-dihydroisoindol-1-one has a molecular weight of 147.18 g/mol, XLogP of 1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 22064671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).