C21H40O4Si — CID 22074424
2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-1-enyl]-1-hydroxycyclohexyl]acetic acid (PubChem CID 22074424) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-1-enyl]-1-hydroxycyclohexyl]acetic acid.
| Compound Name | 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-1-enyl]-1-hydroxycyclohexyl]acetic acid |
|---|---|
| PubChem CID | 22074424 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-1-enyl]-1-hydroxycyclohexyl]acetic acid |
| SMILES | CC(C)(C)C(/C=C/C1CCCC(O)(CC(=O)O)C1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si/c1-19(2,3)17(25-26(7,8)20(4,5)6)12-11-16-10-9-13-21(24,14-16)15-18(22)23/h11-12,16-17,24H,9-10,13-15H2,1-8H3,(H,22,23)/b12-11+ |
| InChIKey | UMIVKIKMFILYAV-VAWYXSNFSA-N |
| XLogP | 5.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|