C24H44O4Si — CID 22074434
2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-5-cyclopentylpent-1-enyl]-1-hydroxycyclohexyl]acetic acid (PubChem CID 22074434) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-5-cyclopentylpent-1-enyl]-1-hydroxycyclohexyl]acetic acid.
| Compound Name | 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-5-cyclopentylpent-1-enyl]-1-hydroxycyclohexyl]acetic acid |
|---|---|
| PubChem CID | 22074434 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-5-cyclopentylpent-1-enyl]-1-hydroxycyclohexyl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(/C=C/C1CCCC(O)(CC(=O)O)C1)CCC1CCCC1 |
| InChI | InChI=1S/C24H44O4Si/c1-23(2,3)29(4,5)28-21(14-12-19-9-6-7-10-19)15-13-20-11-8-16-24(27,17-20)18-22(25)26/h13,15,19-21,27H,6-12,14,16-18H2,1-5H3,(H,25,26)/b15-13+ |
| InChIKey | IKUMXQWMBRMVAP-FYWRMAATSA-N |
| XLogP | 6.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|