C22H18F2N2O4 — CID 22076407
dimethyl 3,4-bis(4-fluoroanilino)benzene-1,2-dicarboxylate (PubChem CID 22076407) has the molecular formula C22H18F2N2O4 and a molecular weight of 412.39 g/mol. Its IUPAC name is dimethyl 3,4-bis(4-fluoroanilino)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3,4-bis(4-fluoroanilino)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 22076407 |
| Molecular Formula | C22H18F2N2O4 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | dimethyl 3,4-bis(4-fluoroanilino)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(Nc2ccc(F)cc2)c(Nc2ccc(F)cc2)c1C(=O)OC |
| InChI | InChI=1S/C22H18F2N2O4/c1-29-21(27)17-11-12-18(25-15-7-3-13(23)4-8-15)20(19(17)22(28)30-2)26-16-9-5-14(24)6-10-16/h3-12,25-26H,1-2H3 |
| InChIKey | BNEAZEPBROSFPL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |