C16H15BrFN3O2 — CID 143382823
methyl 2-(4-bromoanilino)-3-fluoro-4-(methyliminomethylamino)benzoate (PubChem CID 143382823) has the molecular formula C16H15BrFN3O2 and a molecular weight of 380.22 g/mol. Its IUPAC name is methyl 2-(4-bromoanilino)-3-fluoro-4-(methyliminomethylamino)benzoate.
| Compound Name | methyl 2-(4-bromoanilino)-3-fluoro-4-(methyliminomethylamino)benzoate |
|---|---|
| PubChem CID | 143382823 |
| Molecular Formula | C16H15BrFN3O2 |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | methyl 2-(4-bromoanilino)-3-fluoro-4-(methyliminomethylamino)benzoate |
| SMILES | C/N=C/Nc1ccc(C(=O)OC)c(Nc2ccc(Br)cc2)c1F |
| InChI | InChI=1S/C16H15BrFN3O2/c1-19-9-20-13-8-7-12(16(22)23-2)15(14(13)18)21-11-5-3-10(17)4-6-11/h3-9,21H,1-2H3,(H,19,20) |
| InChIKey | XJVWOSNDAXFPLC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|