C16H14FN3O2 — CID 142807797
methyl 7-fluoro-6-(4-methylanilino)-3H-benzimidazole-5-carboxylate (PubChem CID 142807797) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is methyl 7-fluoro-6-(4-methylanilino)-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 7-fluoro-6-(4-methylanilino)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 142807797 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | methyl 7-fluoro-6-(4-methylanilino)-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1cc2[nH]cnc2c(F)c1Nc1ccc(C)cc1 |
| InChI | InChI=1S/C16H14FN3O2/c1-9-3-5-10(6-4-9)20-14-11(16(21)22-2)7-12-15(13(14)17)19-8-18-12/h3-8,20H,1-2H3,(H,18,19) |
| InChIKey | AVPOKSJKFMJGTB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |