C16H11F2IN2O3 — CID 118123889
methyl 7-fluoro-6-(3-fluoro-4-iodoanilino)-3-methyl-2,1-benzoxazole-5-carboxylate (PubChem CID 118123889) has the molecular formula C16H11F2IN2O3 and a molecular weight of 444.18 g/mol. Its IUPAC name is methyl 7-fluoro-6-(3-fluoro-4-iodoanilino)-3-methyl-2,1-benzoxazole-5-carboxylate.
| Compound Name | methyl 7-fluoro-6-(3-fluoro-4-iodoanilino)-3-methyl-2,1-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 118123889 |
| Molecular Formula | C16H11F2IN2O3 |
| Molecular Weight | 444.18 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | methyl 7-fluoro-6-(3-fluoro-4-iodoanilino)-3-methyl-2,1-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1cc2c(C)onc2c(F)c1Nc1ccc(I)c(F)c1 |
| InChI | InChI=1S/C16H11F2IN2O3/c1-7-9-6-10(16(22)23-2)14(13(18)15(9)21-24-7)20-8-3-4-12(19)11(17)5-8/h3-6,20H,1-2H3 |
| InChIKey | PXUUXICGHWECAQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.18 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|