C31H28F2N6O6 — CID 158329558
methyl 4-amino-3-fluoro-2-(2-methylanilino)-5-nitrobenzoate;methyl 7-fluoro-6-(2-methylanilino)-3H-benzimidazole-5-carboxylate (PubChem CID 158329558) has the molecular formula C31H28F2N6O6 and a molecular weight of 618.60 g/mol. Its IUPAC name is methyl 4-amino-3-fluoro-2-(2-methylanilino)-5-nitrobenzoate;methyl 7-fluoro-6-(2-methylanilino)-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 4-amino-3-fluoro-2-(2-methylanilino)-5-nitrobenzoate;methyl 7-fluoro-6-(2-methylanilino)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 158329558 |
| Molecular Formula | C31H28F2N6O6 |
| Molecular Weight | 618.60 g/mol |
| Exact Mass | 618.20 |
| IUPAC Name | methyl 4-amino-3-fluoro-2-(2-methylanilino)-5-nitrobenzoate;methyl 7-fluoro-6-(2-methylanilino)-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N)c(F)c1Nc1ccccc1C.COC(=O)c1cc2[nH]cnc2c(F)c1Nc1ccccc1C |
| InChI | InChI=1S/C16H14FN3O2.C15H14FN3O4/c1-9-5-3-4-6-11(9)20-14-10(16(21)22-2)7-12-15(13(14)17)19-8-18-12;1-8-5-3-4-6-10(8)18-14-9(15(20)23-2)7-11(19(21)22)13(17)12(14)16/h3-8,20H,1-2H3,(H,18,19);3-7,18H,17H2,1-2H3 |
| InChIKey | GPVKLWIRMPAZBZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 174.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|