About 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate
1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate (PubChem CID 160743309) has the molecular formula C16H16N4O4
and a molecular weight of 328.33 g/mol. Its IUPAC name is 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate.
Molecular Properties
| Compound Name | 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate |
| PubChem CID | 160743309 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1.NCc1cccc2[nH]cnc12 |
| InChI | InChI=1S/C8H9N3.C8H7NO4/c9-4-6-2-1-3-7-8(6)11-5-10-7;1-13-8(10)6-3-2-4-7(5-6)9(11)12/h1-3,5H,4,9H2,(H,10,11);2-5H,1H3 |
| InChIKey | RVWIEGFKGWQJKM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate?
The IUPAC name of 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate (CID 160743309) is 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate.
What is the SMILES notation for 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate?
The canonical SMILES for 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate is COC(=O)c1cccc([N+](=O)[O-])c1.NCc1cccc2[nH]cnc12.
What is the InChIKey of 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate?
The InChIKey is RVWIEGFKGWQJKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3.C8H7NO4/c9-4-6-2-1-3-7-8(6)11-5-10-7;1-13-8(10)6-3-2-4-7(5-6)9(11)12/h1-3,5H,4,9H2,(H,10,11);2-5H,1H3.
What are the key properties of 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate?
1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate has a molecular weight of 328.33 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-4-ylmethanamine;methyl 3-nitrobenzoate is sourced from PubChem (CID 160743309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).