C9H6F2N2O2 — CID 122686803
methyl 6,7-difluoro-3H-benzimidazole-4-carboxylate (PubChem CID 122686803) has the molecular formula C9H6F2N2O2 and a molecular weight of 212.16 g/mol. Its IUPAC name is methyl 6,7-difluoro-3H-benzimidazole-4-carboxylate.
| Compound Name | methyl 6,7-difluoro-3H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 122686803 |
| Molecular Formula | C9H6F2N2O2 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | methyl 6,7-difluoro-3H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cc(F)c(F)c2nc[nH]c12 |
| InChI | InChI=1S/C9H6F2N2O2/c1-15-9(14)4-2-5(10)6(11)8-7(4)12-3-13-8/h2-3H,1H3,(H,12,13) |
| InChIKey | CMNTUNQGMQBYDK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |