C17H21F3O5S — CID 22081754
tert-butyl 2-[(4-ethenylphenyl)sulfonyloxymethyl]-3,3,3-trifluoro-2-methylpropanoate (PubChem CID 22081754) has the molecular formula C17H21F3O5S and a molecular weight of 394.41 g/mol. Its IUPAC name is tert-butyl 2-[(4-ethenylphenyl)sulfonyloxymethyl]-3,3,3-trifluoro-2-methylpropanoate.
| Compound Name | tert-butyl 2-[(4-ethenylphenyl)sulfonyloxymethyl]-3,3,3-trifluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 22081754 |
| Molecular Formula | C17H21F3O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | tert-butyl 2-[(4-ethenylphenyl)sulfonyloxymethyl]-3,3,3-trifluoro-2-methylpropanoate |
| SMILES | C=Cc1ccc(S(=O)(=O)OCC(C)(C(=O)OC(C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H21F3O5S/c1-6-12-7-9-13(10-8-12)26(22,23)24-11-16(5,17(18,19)20)14(21)25-15(2,3)4/h6-10H,1,11H2,2-5H3 |
| InChIKey | BKQGZNUNYFHBNY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|