C26H25N3O4 — CID 22083500
N-(4-aminoquinolin-6-yl)-2-[[4-(methoxymethoxymethyl)phenoxy]methyl]benzamide (PubChem CID 22083500) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-(4-aminoquinolin-6-yl)-2-[[4-(methoxymethoxymethyl)phenoxy]methyl]benzamide.
| Compound Name | N-(4-aminoquinolin-6-yl)-2-[[4-(methoxymethoxymethyl)phenoxy]methyl]benzamide |
|---|---|
| PubChem CID | 22083500 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-(4-aminoquinolin-6-yl)-2-[[4-(methoxymethoxymethyl)phenoxy]methyl]benzamide |
| SMILES | COCOCc1ccc(OCc2ccccc2C(=O)Nc2ccc3nccc(N)c3c2)cc1 |
| InChI | InChI=1S/C26H25N3O4/c1-31-17-32-15-18-6-9-21(10-7-18)33-16-19-4-2-3-5-22(19)26(30)29-20-8-11-25-23(14-20)24(27)12-13-28-25/h2-14H,15-17H2,1H3,(H2,27,28)(H,29,30) |
| InChIKey | QDZBHRNYULKIAT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|