C34H29NO4S — CID 22083670
4-[(E)-1-(4-methylsulfonylphenyl)-2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]ethenyl]benzoic acid (PubChem CID 22083670) has the molecular formula C34H29NO4S and a molecular weight of 547.68 g/mol. Its IUPAC name is 4-[(E)-1-(4-methylsulfonylphenyl)-2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-1-(4-methylsulfonylphenyl)-2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 22083670 |
| Molecular Formula | C34H29NO4S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 4-[(E)-1-(4-methylsulfonylphenyl)-2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]ethenyl]benzoic acid |
| SMILES | CC(C)c1cc(-c2cccc(/C=C(\c3ccc(C(=O)O)cc3)c3ccc(S(C)(=O)=O)cc3)c2)c2ncccc2c1 |
| InChI | InChI=1S/C34H29NO4S/c1-22(2)29-20-28-8-5-17-35-33(28)32(21-29)27-7-4-6-23(18-27)19-31(24-9-11-26(12-10-24)34(36)37)25-13-15-30(16-14-25)40(3,38)39/h4-22H,1-3H3,(H,36,37)/b31-19+ |
| InChIKey | UZXRNZAMVTXQCJ-ZCTHSVRISA-N |
| XLogP | 7.72 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|