C35H31NO4S — CID 22083772
methyl 4-[(E)-1-(4-methylsulfonylphenyl)-2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]ethenyl]benzoate (PubChem CID 22083772) has the molecular formula C35H31NO4S and a molecular weight of 561.70 g/mol. Its IUPAC name is methyl 4-[(E)-1-(4-methylsulfonylphenyl)-2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]ethenyl]benzoate.
| Compound Name | methyl 4-[(E)-1-(4-methylsulfonylphenyl)-2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 22083772 |
| Molecular Formula | C35H31NO4S |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | methyl 4-[(E)-1-(4-methylsulfonylphenyl)-2-[3-(6-propan-2-ylquinolin-8-yl)phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(/C(=C\c2cccc(-c3cc(C(C)C)cc4cccnc34)c2)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C35H31NO4S/c1-23(2)30-21-29-9-6-18-36-34(29)33(22-30)28-8-5-7-24(19-28)20-32(25-10-12-27(13-11-25)35(37)40-3)26-14-16-31(17-15-26)41(4,38)39/h5-23H,1-4H3/b32-20+ |
| InChIKey | KJDXIUJIQTYSQZ-UZWMFBFFSA-N |
| XLogP | 7.80 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|