C16H15NO — CID 22084810
5-(2-phenoxyphenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 22084810) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 5-(2-phenoxyphenyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(2-phenoxyphenyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 22084810 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 5-(2-phenoxyphenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | c1ccc(Oc2ccccc2C2=NCCC2)cc1 |
| InChI | InChI=1S/C16H15NO/c1-2-7-13(8-3-1)18-16-11-5-4-9-14(16)15-10-6-12-17-15/h1-5,7-9,11H,6,10,12H2 |
| InChIKey | CZXHMRGFZONMIH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |