C16H14N4O — CID 166389025
6-(2-phenoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 166389025) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is 6-(2-phenoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-(2-phenoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166389025 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 6-(2-phenoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(-c2ccccc2Oc2ccccc2)nc(N)n1 |
| InChI | InChI=1S/C16H14N4O/c17-15-10-13(19-16(18)20-15)12-8-4-5-9-14(12)21-11-6-2-1-3-7-11/h1-10H,(H4,17,18,19,20) |
| InChIKey | XKVVJVGKSZWRDB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |