C16H11NO3 — CID 142659308
3-amino-4-(2-phenoxyphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 142659308) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-amino-4-(2-phenoxyphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-(2-phenoxyphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142659308 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-amino-4-(2-phenoxyphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(-c2ccccc2Oc2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C16H11NO3/c17-14-13(15(18)16(14)19)11-8-4-5-9-12(11)20-10-6-2-1-3-7-10/h1-9H,17H2 |
| InChIKey | SFWPMIHRYNRUCG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|